CymitQuimica logo

CAS 1096689-46-1

:

2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-4-(trifluoromethyl)pyridine

Description:
2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-4-(trifluoromethyl)pyridine is a chemical compound characterized by its unique structural features, which include a pyridine ring substituted with a trifluoromethyl group and a dioxaborolane moiety. The presence of the trifluoromethyl group enhances its lipophilicity and can influence its reactivity and interaction with biological systems. The dioxaborolane part of the molecule contributes to its potential as a boron-containing compound, which may be relevant in various applications, including organic synthesis and medicinal chemistry. This compound is likely to exhibit properties typical of both pyridine derivatives and boron-containing compounds, such as moderate to high stability under standard conditions, potential reactivity with nucleophiles, and possible applications in catalysis or as a building block in the synthesis of more complex molecules. Its specific characteristics, such as solubility, melting point, and reactivity, would depend on the surrounding conditions and the presence of other functional groups in a given reaction context.
Formula:C12H15BF3NO2
InChI:InChI=1S/C12H15BF3NO2/c1-10(2)11(3,4)19-13(18-10)9-7-8(5-6-17-9)12(14,15)16/h5-7H,1-4H3
InChI key:InChIKey=QUTZULRHECZGMR-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C2=CC(C(F)(F)F)=CC=N2
Synonyms:
  • Pyridine, 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-(trifluoromethyl)-
  • 2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-4-(trifluoromethyl)pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.