CAS 1096698-03-1

3-Bromo-4-chloro-5-(trifluoromethyl)benzenamine

Description:

3-Bromo-4-chloro-5-(trifluoromethyl)benzenamine is an aromatic amine characterized by the presence of a bromine atom at the 3-position, a chlorine atom at the 4-position, and a trifluoromethyl group at the 5-position of the benzene ring. This compound features a primary amine functional group, which can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The presence of halogen substituents and the trifluoromethyl group significantly influences its reactivity and polarity, making it a potentially useful intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The trifluoromethyl group enhances lipophilicity and metabolic stability, while the halogens can serve as sites for further functionalization. Additionally, the compound's physical properties, such as solubility and boiling point, are affected by these substituents. Safety and handling precautions should be observed due to the potential toxicity associated with aromatic amines and halogenated compounds.

Formula: C₇H₄BrClF₃N

InChI: InChI=1S/C7H4BrClF3N/c8-5-2-3(13)1-4(6(5)9)7(10,11)12/h1-2H,13H2

InChI key: InChIKey=IXVLAJIQVJQKJZ-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1=C(Cl)C(Br)=CC(N)=C1

Synonyms:

• 3-Bromo-4-chloro-5-(trifluoromethyl)benzenamine
• Benzenamine, 3-bromo-4-chloro-5-(trifluoromethyl)-
• 3-Bromo-4-chloro-5-(trifluoromethyl)aniline

3-Bromo-4-chloro-5-(trifluoromethyl)aniline

CAS: 1096698-03-1

3-Bromo-4-chloro-5-(trifluoromethyl)aniline

Purity: ≥95%

Molecular weight: 274.47g/mol

Ref: 54-PC303573