
CAS 1096708-73-4
:6-Amino-5-chloro-N-[(1S)-1-[5-[[[5-chloro-4-(trifluoromethyl)-2-pyridinyl]amino]carbonyl]-2-thiazolyl]ethyl]-4-pyrimidinecarboxamide
Description:
6-Amino-5-chloro-N-[(1S)-1-[5-[[[5-chloro-4-(trifluoromethyl)-2-pyridinyl]amino]carbonyl]-2-thiazolyl]ethyl]-4-pyrimidinecarboxamide is a complex organic compound characterized by its multi-ring structure, which includes pyrimidine, thiazole, and pyridine moieties. This compound features multiple functional groups, including amino, chloro, and carbonyl groups, contributing to its potential biological activity. The presence of trifluoromethyl and chloro substituents enhances its lipophilicity and may influence its interaction with biological targets. It is often studied for its pharmacological properties, particularly in the context of medicinal chemistry, where such compounds may exhibit anti-cancer or anti-inflammatory activities. The stereochemistry indicated by the (1S) configuration suggests specific spatial arrangements that can affect the compound's reactivity and biological interactions. Overall, this substance is of interest in drug development and research due to its intricate structure and potential therapeutic applications.
Formula:C17H12Cl2F3N7O2S
InChI:InChI=1S/C17H12Cl2F3N7O2S/c1-6(28-15(31)12-11(19)13(23)27-5-26-12)16-25-4-9(32-16)14(30)29-10-2-7(17(20,21)22)8(18)3-24-10/h2-6H,1H3,(H,28,31)(H2,23,26,27)(H,24,29,30)/t6-/m0/s1
InChI key:InChIKey=VWMJHAFYPMOMGF-LURJTMIESA-N
SMILES:C(NC1=CC(C(F)(F)F)=C(Cl)C=N1)(=O)C=2SC([C@@H](NC(=O)C=3C(Cl)=C(N)N=CN3)C)=NC2
Synonyms:- 4-Pyrimidinecarboxamide, 6-amino-5-chloro-N-[(1S)-1-[5-[[[5-chloro-4-(trifluoromethyl)-2-pyridinyl]amino]carbonyl]-2-thiazolyl]ethyl]-
- 6-Amino-5-chloro-N-[(1S)-1-[5-[[[5-chloro-4-(trifluoromethyl)-2-pyridinyl]amino]carbonyl]-2-thiazolyl]ethyl]-4-pyrimidinecarboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
