CAS 109672-71-1

2-FPE

Description:

2-FPE, or 2-fluoropropene, is an unsaturated fluorinated hydrocarbon characterized by its double bond between the second and third carbon atoms in the propene chain. It is a colorless gas at room temperature and has a slightly sweet odor. The presence of the fluorine atom imparts unique properties, such as increased reactivity and potential applications in various chemical syntheses and as a refrigerant. 2-FPE is known for its low global warming potential compared to other fluorinated compounds, making it a subject of interest in environmentally friendly chemical processes. Its molecular structure allows for various reactions, including polymerization and substitution reactions, which can be utilized in the production of fluorinated polymers and other specialty chemicals. Safety considerations are important, as with many fluorinated compounds, due to potential toxicity and environmental impact. Proper handling and storage protocols should be followed to mitigate risks associated with exposure. Overall, 2-FPE represents a versatile compound in the field of organic chemistry and materials science.

Formula: C₁₁H₁₄FNO₆

InChI: InChI=1/C9H12FNO2.C2H2O4/c1-11-5-8(13)6-3-2-4-7(12)9(6)10;3-1(4)2(5)6/h2-4,8,11-13H,5H2,1H3;(H,3,4)(H,5,6)

SMILES: CNCC(c1cccc(c1F)O)O.C(=O)(C(=O)O)O

Synonyms:

• 2-Fluorophenylephrine
• 2-Fluoro-3-[1-Hydroxy-2-(Methylamino)Ethyl]Phenol Ethanedioate (1:1)