CAS 109672-75-5
:6-fluorophenylephrine
Description:
6-Fluorophenylephrine is a synthetic compound that belongs to the class of phenylephrine derivatives, which are primarily known for their use as vasoconstrictors and decongestants. This compound features a fluorine atom substituted at the 6-position of the phenyl ring, which can influence its pharmacological properties and metabolic stability. Typically, phenylephrine and its derivatives are characterized by their ability to selectively activate alpha-1 adrenergic receptors, leading to increased vascular resistance and elevated blood pressure. The presence of the fluorine atom may enhance lipophilicity, potentially affecting the compound's absorption and distribution in biological systems. In terms of physical properties, 6-fluorophenylephrine is likely to be a white to off-white crystalline solid, with solubility in polar solvents. Its applications may extend to therapeutic areas such as nasal congestion relief and hypotension management. However, as with any pharmaceutical compound, the specific safety profile, efficacy, and regulatory status would need to be evaluated through clinical studies and regulatory assessments.
Formula:C11H14FNO6
InChI:InChI=1/C9H12FNO2.C2H2O4/c1-11-5-9(13)7-4-6(12)2-3-8(7)10;3-1(4)2(5)6/h2-4,9,11-13H,5H2,1H3;(H,3,4)(H,5,6)
SMILES:CNCC(c1cc(ccc1F)O)O.C(=O)(C(=O)O)O
Synonyms:- 6-Fpe
- Benzenemethanol, 2-fluoro-5-hydroxy-alpha-((methylamino)methyl)-, (+-)-, ethanedioate (1:1) (salt)
- 4-Fluoro-3-[1-Hydroxy-2-(Methylamino)Ethyl]Phenol Ethanedioate (1:1)
- 6-Fluorophenylephrine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.