CAS 1096790-47-4

3-(Difluoromethoxy)-β-methylbenzeneethanamine

Description:

3-(Difluoromethoxy)-β-methylbenzeneethanamine, identified by its CAS number 1096790-47-4, is a chemical compound that features a benzene ring substituted with a difluoromethoxy group and an ethylamine side chain. This compound is characterized by its unique molecular structure, which includes both fluorine atoms and an ether functional group, contributing to its potential reactivity and solubility properties. The presence of the difluoromethoxy group may enhance its lipophilicity, influencing its interaction with biological systems. Additionally, the β-methyl substitution on the ethylamine chain can affect its steric properties and biological activity. Such compounds are often of interest in medicinal chemistry for their potential pharmacological applications, including roles as neurotransmitter modulators or in other therapeutic areas. The specific characteristics, such as melting point, boiling point, and solubility, would require empirical data for precise determination, but the structural features suggest a compound that could exhibit interesting chemical behavior and biological activity.

Formula: C₁₀H₁₃F₂NO

InChI: InChI=1S/C10H13F2NO/c1-7(6-13)8-3-2-4-9(5-8)14-10(11)12/h2-5,7,10H,6,13H2,1H3

InChI key: InChIKey=ARDHVAPZVXMAEQ-UHFFFAOYSA-N

SMILES: C(CN)(C)C1=CC(OC(F)F)=CC=C1

Synonyms:

• 3-(Difluoromethoxy)-β-methylbenzeneethanamine
• Benzeneethanamine, 3-(difluoromethoxy)-β-methyl-