CAS 109684-03-9
:Phenyl-methyl -hydroxybenzenebutanoate
Description:
Phenyl-methyl-hydroxybenzenebutanoate, with the CAS number 109684-03-9, is an organic compound that belongs to the class of esters. It is characterized by the presence of a phenyl group, a methyl group, and a hydroxy group attached to a butanoate moiety. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water due to its hydrophobic aromatic components. The hydroxy group can impart some polar characteristics, potentially influencing its reactivity and interactions with other substances. Phenyl-methyl-hydroxybenzenebutanoate may be utilized in various applications, including as a fragrance or flavoring agent, or in the formulation of cosmetic products, owing to its aromatic properties. Additionally, the presence of the ester functional group suggests that it may undergo hydrolysis under certain conditions, leading to the release of the corresponding alcohol and acid. As with many organic compounds, safety data should be consulted to understand its handling, storage, and potential hazards.
Formula:C17H18O3
InChI:InChI=1/C17H18O3/c18-16(12-11-14-7-3-1-4-8-14)17(19)20-13-15-9-5-2-6-10-15/h1-10,16,18H,11-13H2
SMILES:c1ccc(cc1)CCC(C(=O)OCc1ccccc1)O
Synonyms:- Benzyl 2-hydroxy-4-phenylbutyrate
- Benzyl 2-Hydroxy-4-Phenylbutanoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
