CAS 1096841-93-8

N-(Cyclopentylmethyl)urea

Description:

N-(Cyclopentylmethyl)urea is an organic compound characterized by its urea functional group, which is central to its structure. It features a cyclopentylmethyl group attached to the nitrogen atom of the urea moiety, contributing to its unique properties. This compound is typically a white to off-white solid at room temperature and is soluble in polar solvents, which is common for urea derivatives. The presence of the cyclopentyl group may influence its hydrophobicity and steric properties, potentially affecting its biological activity and interactions. N-(Cyclopentylmethyl)urea may be of interest in pharmaceutical research and development due to its potential applications in medicinal chemistry, particularly in the design of compounds with specific biological activities. Its molecular structure allows for various interactions, making it a candidate for further studies in drug formulation and synthesis. As with many urea derivatives, it may exhibit hydrogen bonding capabilities, which can play a significant role in its reactivity and solubility profiles.

Formula: C₇H₁₄N₂O

InChI: InChI=1S/C7H14N2O/c8-7(10)9-5-6-3-1-2-4-6/h6H,1-5H2,(H3,8,9,10)

InChI key: InChIKey=CXILIZHOBKFGHS-UHFFFAOYSA-N

SMILES: C(NC(N)=O)C1CCCC1

Synonyms:

• N-(Cyclopentylmethyl)urea
• Urea, N-(cyclopentylmethyl)-