CAS 1096868-02-8: 4-(2-Methyl-4-thiazolyl)-1H-pyrrole-3-carboxylic acid

Description: 4-(2-Methyl-4-thiazolyl)-1H-pyrrole-3-carboxylic acid is a chemical compound characterized by its unique structural features, which include a pyrrole ring and a thiazole moiety. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity and solubility in various organic solvents. The presence of the carboxylic acid functional group suggests that it can participate in acid-base reactions and may exhibit polar characteristics, influencing its solubility in water. The thiazole ring contributes to the compound's potential reactivity and interaction with biological systems, making it of interest in medicinal chemistry and drug development. Additionally, the methyl group on the thiazole ring can affect the compound's steric and electronic properties, potentially influencing its pharmacological profile. Overall, this compound's unique structure and functional groups may provide avenues for further research into its applications in pharmaceuticals or agrochemicals.

Formula: C₉H₈N₂O₂S

InChI: InChI=1S/C9H8N2O2S/c1-5-11-8(4-14-5)6-2-10-3-7(6)9(12)13/h2-4,10H,1H3,(H,12,13)

InChI key: InChIKey=BJUBKZBRKKYOHV-UHFFFAOYSA-N

SMILES: O=C(O)C1=CNC=C1C=2N=C(SC2)C

Synonyms:

• 1H-Pyrrole-3-carboxylic acid, 4-(2-methyl-4-thiazolyl)-
• 4-(2-Methyl-4-thiazolyl)-1H-pyrrole-3-carboxylic acid

4-(2-Methyl-1,3-thiazol-4-yl)-1H-pyrrole-3-carboxylic acid

CAS: 1096868-02-8

Versatile small molecule scaffold

• Formula: C₉H₈N₂O₂S
• Purity: Min. 95%
• Molecular weight: 208.24 g/mol

4-(2-Methyl-1,3-thiazol-4-yl)-1h-pyrrole-3-carboxylic acid

CAS: 1096868-02-8

• Purity: 95%
• Molecular weight: 208.24000549316406