CAS 1096875-97-6

5-Bromo-2-chloro-N-(1-methylethyl)benzenemethanamine

Description:

5-Bromo-2-chloro-N-(1-methylethyl)benzenemethanamine is an organic compound characterized by its complex structure, which includes a benzene ring substituted with both bromine and chlorine atoms, as well as an amine functional group. The presence of the bromine and chlorine substituents indicates that this compound may exhibit unique reactivity patterns, particularly in electrophilic aromatic substitution reactions. The N-(1-methylethyl) group suggests that the amine is tertiary, which can influence the compound's basicity and steric hindrance. This compound may be of interest in medicinal chemistry and material science due to its potential biological activity and ability to participate in further chemical transformations. Its molecular structure contributes to its physical properties, such as solubility and melting point, which are influenced by the halogen substituents and the alkyl group. As with many halogenated compounds, it is essential to consider environmental and safety aspects, as halogens can impact toxicity and persistence in biological systems.

Formula: C₁₀H₁₃BrClN

InChI: InChI=1S/C10H13BrClN/c1-7(2)13-6-8-5-9(11)3-4-10(8)12/h3-5,7,13H,6H2,1-2H3

InChI key: InChIKey=FBKKLBHNXSFAIA-UHFFFAOYSA-N

SMILES: C(NC(C)C)C1=C(Cl)C=CC(Br)=C1

Synonyms:

• Benzenemethanamine, 5-bromo-2-chloro-N-(1-methylethyl)-
• 5-Bromo-2-chloro-N-(1-methylethyl)benzenemethanamine