CAS 109690-46-2

1-ethyl-2,3,4,9-tetrahydro-1H-beta-carboline-3-carboxylic acid

Description:

1-Ethyl-2,3,4,9-tetrahydro-1H-beta-carboline-3-carboxylic acid, with the CAS number 109690-46-2, is a chemical compound belonging to the beta-carboline family, which is known for its diverse biological activities. This compound features a bicyclic structure that includes a carboxylic acid functional group, contributing to its potential as a bioactive molecule. It is characterized by its ethyl substitution at the nitrogen atom, which can influence its pharmacological properties. The tetrahydro-beta-carboline framework is often associated with neuroactive effects, and compounds in this class have been studied for their roles in neurotransmission and potential therapeutic applications, including neuroprotection and antidepressant effects. The presence of the carboxylic acid group may enhance its solubility in polar solvents and facilitate interactions with biological targets. Overall, this compound represents a significant interest in medicinal chemistry due to its structural features and potential biological implications.

Formula: C₁₄H₁₆N₂O₂

InChI: InChI=1/C14H16N2O2/c1-2-10-13-9(7-12(15-10)14(17)18)8-5-3-4-6-11(8)16-13/h3-6,10,12,15-16H,2,7H2,1H3,(H,17,18)

SMILES: CCC1c2c(CC(C(=O)O)N1)c1ccccc1[nH]2