CAS 1096935-51-1

3-Amino-N-[2-(difluoromethoxy)phenyl]-4-methylbenzamide

Description:

3-Amino-N-[2-(difluoromethoxy)phenyl]-4-methylbenzamide is a chemical compound characterized by its specific functional groups and structural features. It contains an amine group (-NH2), which contributes to its basicity and potential reactivity. The presence of a difluoromethoxy group indicates that the compound has fluorine atoms attached to a methoxy group, which can influence its electronic properties and lipophilicity. The compound also features a benzamide structure, which is known for its stability and ability to participate in hydrogen bonding. This compound may exhibit biological activity due to its structural components, making it of interest in medicinal chemistry. Its molecular interactions could be significant in drug design, particularly in targeting specific biological pathways. Additionally, the presence of multiple aromatic rings suggests potential for π-π stacking interactions, which can be relevant in various chemical and biological processes. Overall, the unique combination of functional groups and structural elements makes this compound a subject of interest for further research and application in various fields.

Formula: C₁₅H₁₄F₂N₂O₂

InChI: InChI=1S/C15H14F2N2O2/c1-9-6-7-10(8-11(9)18)14(20)19-12-4-2-3-5-13(12)21-15(16)17/h2-8,15H,18H2,1H3,(H,19,20)

InChI key: InChIKey=QUGOLGXQRHKNAL-UHFFFAOYSA-N

SMILES: N(C(=O)C1=CC(N)=C(C)C=C1)C2=C(OC(F)F)C=CC=C2

Synonyms:

• Benzamide, 3-amino-N-[2-(difluoromethoxy)phenyl]-4-methyl-
• 3-Amino-N-[2-(difluoromethoxy)phenyl]-4-methylbenzamide