CAS 109719-79-1
:1,2,3,7,8-pentachloro(~13~C_12_)oxanthrene
Description:
1,2,3,7,8-Pentachlorooxanthrene, identified by CAS number 109719-79-1, is a chlorinated aromatic compound characterized by the presence of five chlorine atoms attached to an oxanthrene structure. This compound exhibits a complex molecular framework, which contributes to its unique chemical properties. It is typically solid at room temperature and may display a range of colors depending on its purity and specific structural isomers. The chlorination enhances its stability and hydrophobicity, making it less soluble in water but more soluble in organic solvents. Due to its chlorinated nature, it may exhibit significant environmental persistence and potential bioaccumulation. The compound is of interest in various fields, including environmental chemistry and toxicology, as it may be associated with adverse ecological effects. Its synthesis and degradation pathways are also subjects of research, particularly in the context of understanding the behavior of chlorinated organic compounds in the environment. Safety precautions are essential when handling this substance due to its potential toxicity and environmental impact.
Formula:13C12H3Cl5O2
InChI:InChI=1/C12H3Cl5O2/c13-4-1-7-8(2-5(4)14)19-12-9(18-7)3-6(15)10(16)11(12)17/h1-3H/i1+1,2+1,3+1,4+1,5+1,6+1,7+1,8+1,9+1,10+1,11+1,12+1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1,2,3,7,8-Pentachloro[13C12]dibenzo-p-dioxin
CAS:Controlled ProductFormula:C12H3Cl5O2Color and Shape:NeatMolecular weight:368.33
