CymitQuimica logo

CAS 109719-83-7

:

1,2,3,4,6,7,8-heptachloro(~13~C_12_)oxanthrene

Description:
1,2,3,4,6,7,8-Heptachlorooxanthrene, with the CAS number 109719-83-7, is a synthetic organic compound characterized by its complex chlorinated structure. It belongs to the class of polycyclic aromatic compounds, specifically oxanthrenes, which are known for their fused ring systems. The presence of seven chlorine atoms significantly influences its chemical properties, including increased hydrophobicity and potential bioaccumulation. This compound is typically solid at room temperature and exhibits low volatility. Its chlorinated nature may impart stability against degradation, making it persistent in the environment. Additionally, heptachlorooxanthrene may exhibit unique electronic properties due to the arrangement of its aromatic rings and chlorine substituents, which can affect its reactivity and interactions with biological systems. Due to its potential environmental and health implications, compounds like this are often subject to regulatory scrutiny. Overall, the characteristics of 1,2,3,4,6,7,8-heptachlorooxanthrene highlight its significance in studies related to environmental chemistry and toxicology.
Formula:C12HCl7O2
InChI:InChI=1/C12HCl7O2/c13-2-1-3-10(7(17)4(2)14)21-12-9(19)6(16)5(15)8(18)11(12)20-3/h1H/i1+1,2+1,3+1,4+1,5+1,6+1,7+1,8+1,9+1,10+1,11+1,12+1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
  • Heptachloro[13C12]dibenzo-p-dioxin

    Controlled Product
    CAS:
    Formula:C12HCl7O2
    Color and Shape:Neat
    Molecular weight:437.22

    Ref: TR-H265002

    10mg
    9,409.00€