CAS 109755-36-4

4-CHLORO-6-NITROSO-RESORCINOL

Description:

4-Chloro-6-nitroso-resorcinol is an organic compound characterized by the presence of both a chloro and a nitroso functional group attached to a resorcinol backbone. This compound typically appears as a solid and is known for its potential applications in various fields, including dye chemistry and as a reagent in organic synthesis. The presence of the nitroso group contributes to its reactivity, making it useful in the formation of azo compounds and other derivatives. Additionally, the chlorine substituent can influence the compound's solubility and stability in different solvents. Its molecular structure allows for potential interactions with biological systems, which may be of interest in pharmacological studies. Safety data indicates that, like many nitro and chloro compounds, it should be handled with care due to potential toxicity and environmental concerns. Overall, 4-chloro-6-nitroso-resorcinol is a versatile compound with significant implications in both industrial and research applications.

Formula: C₆H₄ClNO₃

InChI: InChI=1/C6H4ClNO3/c7-3-1-4(8-11)6(10)2-5(3)9/h1-2,9-10H

SMILES: c1c(c(cc(c1N=O)O)O)Cl

Synonyms:

• 4-Chloro-6-Nitrosobenzene-1,3-Diol

1,3-Benzenediol, 4-chloro-6-nitroso-

CAS: 109755-36-4

Formula: C₆H₄ClNO₃

Color and Shape: Solid

Molecular weight: 173.5539

Ref: IN-DA007SH1

4-Chloro-6-nitrosoresorcinol-d1

Controlled Product

CAS: 109755-36-4

Applications 4-Chloro-6-nitrosoresorcinol-d1 is the labeled analogue of 4-Chloro-6-nitrosoresorcinol (C374860). 4-Chloro-6-nitrosoresorcinol-d1 is an intermediate in the synthesis of 6-Hydroxy Chlorzoxazone-d2 (H825123), a labeled analogue of 6-Hydroxy Chlorzoxazone (H825120), A major metabolite of chlorzoxazone and formed by the actions of cytochrome P450IIE1.
References Twele, et al.: Arzneim.-Forsch., 32, 759 (1982); Peter, et al.: che. Res. Toxicol., 3, 566 (1990)

Formula: C₆H₃DClNO₃

Color and Shape: Neat

Molecular weight: 174.56

Ref: TR-C374864