CAS 109766-61-2
:jietacin A
Description:
Jietacin A, with the CAS number 109766-61-2, is a natural product that belongs to the class of compounds known as alkaloids. It is primarily derived from certain plant species and is noted for its complex molecular structure, which contributes to its biological activity. Jietacin A exhibits a range of pharmacological properties, including potential anti-inflammatory and antimicrobial effects, making it of interest in medicinal chemistry and pharmacology. The compound's mechanism of action is often linked to its ability to interact with specific biological targets, although detailed studies are ongoing to fully elucidate these interactions. Additionally, like many alkaloids, Jietacin A may exhibit varying solubility in different solvents, influencing its bioavailability and efficacy in therapeutic applications. Research into Jietacin A continues to explore its potential uses in drug development and its role in traditional medicine, highlighting the importance of natural products in the discovery of new therapeutic agents.
Formula:C18H34N2O2
InChI:InChI=1/C18H34N2O2/c1-4-20(22)19-16-12-7-5-6-10-14-18(21)15-11-8-9-13-17(2)3/h4,17H,1,5-16H2,2-3H3/b20-19-
Synonyms:- Jietacin
- 14-Methyl-1-(ethenyl-ONN-azoxy)pentadecan-8-one
- jietacin A
- 1-(Ethenyl-ONN-azoxy)-14-methyl-8-pentadecanone
- Jietacin A
- Jietacine A
- 8-Pentadecanone, 1-(ethenyl-ONN-azoxy)-14-methyl-
- 1-[(Z)-ethenyl-ONN-azoxy]-14-methylpentadecan-8-one
- Jietacine A
- BRN 5538455
- 8-Pentadecanone, 1-(2-ethenyl-2-oxidodiazenyl)-14-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Jietacin A
CAS:<p>Jietacin A exhibits nematocidal activity, capable of killing Burs helenchus Lignicolus at a concentration of 0.25 μg/mL.</p>Formula:C18H34N2O2Color and Shape:SolidMolecular weight:310.475
