CymitQuimica logo

CAS 1097779-02-6

:

9H-Fluoren-9-ylmethyl 4-formyl-1-piperidinecarboxylate

Description:
9H-Fluoren-9-ylmethyl 4-formyl-1-piperidinecarboxylate, identified by its CAS number 1097779-02-6, is a chemical compound characterized by its unique structural features. It consists of a fluorenylmethyl group, which is a polycyclic aromatic hydrocarbon, attached to a piperidine ring that contains a formyl and a carboxylate functional group. This compound is typically used in organic synthesis and medicinal chemistry due to its potential biological activity. The presence of the piperidine moiety suggests possible interactions with biological targets, making it of interest in drug development. Its solubility and reactivity can vary based on the solvent and conditions used, which is crucial for its application in synthetic pathways. Additionally, the compound's stability and behavior under different pH conditions can influence its utility in various chemical reactions. Overall, 9H-Fluoren-9-ylmethyl 4-formyl-1-piperidinecarboxylate represents a versatile building block in the synthesis of more complex organic molecules.
Formula:C21H21NO3
InChI:InChI=1S/C21H21NO3/c23-13-15-9-11-22(12-10-15)21(24)25-14-20-18-7-3-1-5-16(18)17-6-2-4-8-19(17)20/h1-8,13,15,20H,9-12,14H2
InChI key:InChIKey=TUSOHIVVKREBMF-UHFFFAOYSA-N
SMILES:C(OC(=O)N1CCC(C=O)CC1)C2C=3C(C=4C2=CC=CC4)=CC=CC3
Synonyms:
  • 1-Piperidinecarboxylic acid, 4-formyl-, 9H-fluoren-9-ylmethyl ester
  • 9H-Fluoren-9-ylmethyl 4-formyl-1-piperidinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.