CAS 1097785-67-5

4-(2-Amino-4-methylphenyl)-2-piperazinone

Description:

4-(2-Amino-4-methylphenyl)-2-piperazinone, identified by its CAS number 1097785-67-5, is a chemical compound characterized by its piperazinone structure, which includes a piperazine ring and an amino-substituted aromatic group. This compound typically exhibits properties associated with both amines and ketones, such as potential basicity due to the presence of the amino group and the ability to participate in hydrogen bonding. It may be soluble in polar solvents, reflecting the influence of its functional groups. The presence of the methyl group on the aromatic ring can affect its electronic properties and steric hindrance, potentially influencing its reactivity and interactions with biological targets. Compounds of this nature are often investigated for their pharmacological properties, including potential applications in medicinal chemistry. However, specific biological activity, toxicity, and stability would require further empirical studies to elucidate. Overall, 4-(2-Amino-4-methylphenyl)-2-piperazinone represents a class of compounds that may have significant implications in drug development and chemical synthesis.

Formula: C₁₁H₁₅N₃O

InChI: InChI=1S/C11H15N3O/c1-8-2-3-10(9(12)6-8)14-5-4-13-11(15)7-14/h2-3,6H,4-5,7,12H2,1H3,(H,13,15)

InChI key: InChIKey=WNCAOAZAQZTXLU-UHFFFAOYSA-N

SMILES: NC1=C(N2CC(=O)NCC2)C=CC(C)=C1

Synonyms:

• 4-(2-Amino-4-methylphenyl)-2-piperazinone
• 2-Piperazinone, 4-(2-amino-4-methylphenyl)-