CAS 1097790-45-8
:3,4-Dihydro-2H-1-benzopyran-3-carboxylic acid hydrazide
Description:
3,4-Dihydro-2H-1-benzopyran-3-carboxylic acid hydrazide is an organic compound characterized by its unique structural features, which include a benzopyran ring system and a hydrazide functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and biological activity. The presence of the hydrazide moiety suggests that it may participate in various chemical reactions, such as hydrazone formation or condensation reactions. Additionally, the benzopyran structure is known for its role in various pharmacological activities, including antioxidant and anti-inflammatory properties. The compound may also exhibit solubility in polar solvents due to the carboxylic acid group, which can engage in hydrogen bonding. Its specific applications and biological effects would depend on further studies, including its interaction with biological targets and its stability under different conditions. Overall, 3,4-Dihydro-2H-1-benzopyran-3-carboxylic acid hydrazide represents a compound of interest in medicinal chemistry and organic synthesis.
Formula:C10H12N2O2
InChI:InChI=1S/C10H12N2O2/c11-12-10(13)8-5-7-3-1-2-4-9(7)14-6-8/h1-4,8H,5-6,11H2,(H,12,13)
InChI key:InChIKey=CRZHHAIRMIQRBN-UHFFFAOYSA-N
SMILES:C(NN)(=O)C1CC=2C(OC1)=CC=CC2
Synonyms:- 3,4-Dihydro-2H-1-benzopyran-3-carboxylic acid hydrazide
- 2H-1-Benzopyran-3-carboxylic acid, 3,4-dihydro-, hydrazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.