CAS 109785-20-8: lactosyl lysosphingolipid
Description:Lactosyl lysosphingolipid is a glycosphingolipid characterized by its unique structure, which includes a lactosyl moiety linked to a lysophospholipid backbone. This compound is notable for its role in cellular processes, particularly in cell signaling and membrane dynamics. It is often involved in the modulation of immune responses and can influence cell-cell interactions. The presence of the lactosyl group contributes to its hydrophilic properties, while the lysosphingolipid structure imparts hydrophobic characteristics, allowing it to integrate into lipid bilayers effectively. This amphiphilic nature is crucial for its biological functions, including its involvement in lipid rafts and membrane microdomains. Additionally, lactosyl lysosphingolipid may play a role in various pathological conditions, including certain cancers and neurodegenerative diseases, making it a subject of interest in biomedical research. Its CAS number, 109785-20-8, is a unique identifier that facilitates the tracking and study of this compound in scientific literature and databases.
Formula:C30H57NO12
InChI:InChI=1/C30H57NO12/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-20(34)19(31)18-40-29-27(39)25(37)28(22(17-33)42-29)43-30-26(38)24(36)23(35)21(16-32)41-30/h14-15,19-30,32-39H,2-13,16-18,31H2,1H3/b15-14+/t19-,20+,21+,22+,23-,24-,25+,26+,27+,28+,29+,30-/m0/s1
- Synonyms:
- (R-(R*,S*-(E)))-2-Amino-3-hydroxy-4-octadecenyl 4-O-beta-D-galactopyranosyl-beta-D-glucopyranoside
- Lactosyllysosphingolipid
- beta-D-Glucopyranoside, 2-amino-3-hydroxy-4-octadecenyl 4-O-beta-D-galactopyranosyl-, (R-(R*,S*-(E)))-
- (2S,3R,4E)-2-amino-3-hydroxyoctadec-4-en-1-yl 4-O-beta-D-galactopyranosyl-beta-D-glucopyranoside
- Lactosyl lysosphingolipid
- D-LACTOSYL-1-1'-D-ERYTHRO-SPHINGOSINE