CAS 109789-17-5
:cis-Hexahydro-3-methylene-furo[2,3-b]furan
Description:
Cis-Hexahydro-3-methylene-furo[2,3-b]furan, identified by its CAS number 109789-17-5, is a chemical compound characterized by its unique bicyclic structure, which includes a furan ring fused to a cyclohexane moiety. This compound features a methylene group at the 3-position of the furan, contributing to its reactivity and potential applications in organic synthesis. The "cis" designation indicates the specific stereochemistry of the substituents around the ring system, which can influence its physical and chemical properties, such as boiling point, solubility, and reactivity. Typically, compounds of this type may exhibit interesting biological activities, making them of interest in medicinal chemistry and materials science. Additionally, the presence of multiple functional groups can lead to diverse reactivity patterns, allowing for various synthetic transformations. Overall, cis-Hexahydro-3-methylene-furo[2,3-b]furan represents a fascinating subject for further research in both theoretical and applied chemistry contexts.
Formula:C7H10O2
InChI:InChI=1/C7H10O2/c1-5-4-9-7-6(5)2-3-8-7/h6-7H,1-4H2/t6-,7+/m1/s1
Synonyms:- (+/-)-Hexahydro-3-methylene-cis-furo[2,3-b]furan
- (3aR,6aS)-3-methylidenehexahydrofuro[2,3-b]furan
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.