CAS 109789-21-1
:rel-(3aR,6aS)-2,3,3a,6a-Tetrahydrofuro[2,3-b]furan
Description:
Rel-(3aR,6aS)-2,3,3a,6a-Tetrahydrofuro[2,3-b]furan is a bicyclic organic compound characterized by its unique fused ring structure, which includes a furan moiety. This compound features a tetrahydrofuran ring that contributes to its stability and reactivity. The stereochemistry indicated by the rel-(3aR,6aS) designation suggests specific spatial arrangements of the substituents around the chiral centers, which can influence its biological activity and interactions. Typically, compounds of this nature may exhibit properties such as solubility in organic solvents and potential reactivity with electrophiles or nucleophiles due to the presence of functional groups. The compound may also be of interest in synthetic organic chemistry and medicinal chemistry, where its structural features could be leveraged for the development of pharmaceuticals or agrochemicals. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, would be determined through experimental methods and could vary based on purity and environmental conditions.
Formula:C6H8O2
InChI:InChI=1/C6H8O2/c1-3-7-6-5(1)2-4-8-6/h1,3,5-6H,2,4H2/t5-,6+/s2
InChI key:InChIKey=YJHXIHVWEGRVLQ-MZQZIECVNA-N
SMILES:[C@]12([C@@](OC=C1)(OCC2)[H])[H]
Synonyms:- Furo[2,3-b]furan, 2,3,3a,6a-tetrahydro-, cis-
- rel-(3aR,6aS)-2,3,3a,6a-Tetrahydrofuro[2,3-b]furan
- Furo[2,3-b]furan, 2,3,3a,6a-tetrahydro-, (3aR,6aS)-rel-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
cis-2,3,3a,6a-Tetrahydro-furo[2,3-b]furan
CAS:Controlled ProductFormula:C6H8O2Color and Shape:NeatMolecular weight:112.126
