CAS 109794-97-0

Benzo[b]pyrido[2,3,4-gh]pyrrolizine, 1,2,4,5-tetrahydro-8-methoxy-4,4-dimethyl-

Description:

Benzo[b]pyrido[2,3,4-gh]pyrrolizine, 1,2,4,5-tetrahydro-8-methoxy-4,4-dimethyl- is a complex organic compound characterized by its polycyclic structure, which incorporates both pyrrolizine and pyridine moieties. This compound features a tetrahydro configuration, indicating the presence of a saturated ring system, and includes methoxy and dimethyl substituents that contribute to its chemical properties and reactivity. The presence of these functional groups can influence its solubility, stability, and potential biological activity. As a member of the larger class of heterocyclic compounds, it may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. The compound's CAS number, 109794-97-0, serves as a unique identifier for regulatory and research purposes. Its synthesis and characterization would typically involve advanced organic chemistry techniques, and its applications could range from pharmaceuticals to materials science, depending on its specific properties and interactions with biological systems.

Formula: C₁₆H₁₈N₂O

InChI: InChI=1S/C16H18N2O/c1-16(2)9-18-13-8-10(19-3)4-5-11(13)12-6-7-17-15(16)14(12)18/h4-5,8H,6-7,9H2,1-3H3

InChI key: InChIKey=CTEKBWZEYYSNFV-UHFFFAOYSA-N

SMILES: CC1(C)C=2C=3N(C=4C(C3CCN2)=CC=C(OC)C4)C1

Synonyms:

• Harmalidine
• Benzo[b]pyrido[2,3,4-gh]pyrrolizine, 1,2,4,5-tetrahydro-8-methoxy-4,4-dimethyl-

Harmalidine

CAS: 109794-97-0

Harmalidine is an alkaloid compound, which is derived from the Peganum harmala plant, commonly known as Syrian rue. This compound is known for its psychoactive properties due to its ability to influence neurotransmitter activity within the brain. Harmalidine acts primarily as a monoamine oxidase inhibitor (MAOI), blocking the breakdown of monoamines such as serotonin, dopamine, and norepinephrine. By inhibiting these enzymes, harmalidine increases the availability of these neurotransmitters, which are critical for mood regulation and cognitive function.

Formula: C₁₆H₁₈N₂O

Purity: Min. 95%

Molecular weight: 254.33 g/mol

Ref: 3D-JEA79497