CAS 109808-50-6
:2-dimethylaminoethyl N-(3-ethoxyphenyl)-N-phenyl-carbamate
Description:
2-Dimethylaminoethyl N-(3-ethoxyphenyl)-N-phenyl-carbamate, with the CAS number 109808-50-6, is a chemical compound that belongs to the class of carbamates. This substance typically exhibits characteristics such as being a white to off-white solid or crystalline powder, depending on its purity and formulation. It is soluble in organic solvents, which may include alcohols and some ethers, but its solubility in water is generally limited. The compound features a dimethylamino group, which can impart basic properties, and the presence of ethoxy and phenyl groups contributes to its hydrophobic characteristics. Its structure suggests potential applications in pharmaceuticals or agrochemicals, particularly due to the presence of the carbamate functional group, which is known for its biological activity. Safety data should be consulted for handling and exposure risks, as carbamates can exhibit varying degrees of toxicity. Overall, this compound's unique functional groups and structural features make it of interest in various chemical research and industrial applications.
Formula:C19H24N2O3
InChI:InChI=1/C19H24N2O3/c1-4-23-18-12-8-11-17(15-18)21(16-9-6-5-7-10-16)19(22)24-14-13-20(2)3/h5-12,15H,4,13-14H2,1-3H3
Synonyms:- 2-(dimethylamino)ethyl (3-ethoxyphenyl)phenylcarbamate
- K 78
- Carbanilic acid, m-ethoxy-N-phenyl-, 2-(dimethylamino)ethyl ester
- (m-Ethoxyphenyl)phenylcarbamic acid 2-(dimethylamino)ethyl ester
- BRN 3419712
- m-Ethoxy-N-phenylcarbanilic acid 2-(dimethylamino)ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Carbanilic acid, m-ethoxy-N-phenyl-, 2-(dimethylamino)ethyl ester
CAS:Carbanilic acid, m-ethoxy-N-phenyl-, 2-(dimethylamino)ethyl ester is a bioactive chemical.Formula:C19H24N2O3Color and Shape:SolidMolecular weight:328.41
