CAS 1098102-94-3: 4,8-Bis(octyloxy)benzo[1,2-b:4,5-b′]dithiophene
Description:4,8-Bis(octyloxy)benzo[1,2-b:4,5-b′]dithiophene is an organic compound characterized by its unique structure, which includes a dithiophene core substituted with octyloxy groups. This compound is notable for its potential applications in organic electronics, particularly in organic photovoltaics and field-effect transistors, due to its favorable electronic properties and good solubility. The presence of the octyloxy substituents enhances its solubility in organic solvents, facilitating processing and integration into various devices. Additionally, the dithiophene moiety contributes to its ability to form π-π stacking interactions, which are crucial for charge transport in electronic applications. The compound typically exhibits good thermal stability and can be synthesized through various organic reactions, making it a subject of interest in materials science and organic chemistry research. Its properties, such as absorption spectra and charge mobility, can be influenced by the length and nature of the alkoxy substituents, allowing for tunable electronic characteristics.
Formula:C26H38O2S2
InChI:InChI=1S/C26H38O2S2/c1-3-5-7-9-11-13-17-27-23-21-15-19-30-26(21)24(22-16-20-29-25(22)23)28-18-14-12-10-8-6-4-2/h15-16,19-20H,3-14,17-18H2,1-2H3
InChI key:InChIKey=LWSGUMOETOXOHL-UHFFFAOYSA-N
SMILES:O(C=1C=2SC=CC2C(OCCCCCCCC)=C3SC=CC13)CCCCCCCC
- Synonyms:
- 4,8-Bis(octyloxy)benzo[1,2-b:4,5-b']dithiophene
- 4,8-Bis(octyloxy)thieno[2,3-f][1]benzothiophene
- 4,8-Dioctyloxybenzo[1,2-b:4,5-b']dithiophene
- Benzo[1,2-b:4,5-b′]dithiophene, 4,8-bis(octyloxy)-
- K0214
- 4,8-Dioctyloxybenzo[1,2-b;3,4-b′]dithiophene
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 4,8-Bis-n-octyloxybenzo[1,2-b:4,5-b']dithiophene REF: 3B-B4396CAS: 1098102-94-3 | >98.0%(GC) | 96.00 €~318.00 € | Mon 10 Mar 25 |
![]() | 4,8-Dioctyloxybenzo[1,2-b REF: IN-DA00945XCAS: 1098102-94-3 | 98% | 53.00 €~201.00 € | Mon 17 Mar 25 |
![]() | 4,8-Bis-n-octyloxybenzo[1,2-b:4,5-b']dithiophene REF: 3D-YTB10294CAS: 1098102-94-3 | Min. 95% | - - - | Discontinued product |

4,8-Bis-n-octyloxybenzo[1,2-b:4,5-b']dithiophene
Ref: 3B-B4396
1g | 318.00 € | ||
200mg | 96.00 € |

4,8-Dioctyloxybenzo[1,2-b
Ref: IN-DA00945X
1g | 201.00 € | ||
100mg | 86.00 € | ||
250mg | 110.00 € |

4,8-Bis-n-octyloxybenzo[1,2-b:4,5-b']dithiophene
Ref: 3D-YTB10294
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |