
CAS 109826-27-9
:2H-Benzimidazol-2-one, 1,3-dihydro-1-[1-[(4-methyl-4H,6H-pyrrolo[1,2-a][4,1]benzoxazepin-4-yl)methyl]-4-piperidinyl]-, (2Z)-2-butenedioate (1:1)
Description:
2H-Benzimidazol-2-one, 1,3-dihydro-1-[1-[(4-methyl-4H,6H-pyrrolo[1,2-a][4,1]benzoxazepin-4-yl)methyl]-4-piperidinyl]-, (2Z)-2-butenedioate (1:1), identified by CAS number 109826-27-9, is a complex organic compound characterized by its unique structural features, including a benzimidazole core and a piperidine moiety. This compound exhibits properties typical of heterocyclic compounds, such as potential biological activity, which may include antimicrobial or anticancer effects, although specific biological data may vary. The presence of the butenedioate moiety suggests potential for reactivity in various chemical environments, possibly influencing its solubility and stability. Additionally, the compound's intricate structure may contribute to its pharmacological properties, making it of interest in medicinal chemistry. Its synthesis and characterization would typically involve advanced organic synthesis techniques, and its applications could span pharmaceuticals or agrochemicals, depending on its efficacy and safety profile. Further studies would be necessary to fully elucidate its properties and potential uses.
Formula:C26H28N4O2·C4H4O4
InChI:InChI=1S/C26H28N4O2.C4H4O4/c1-26(24-11-6-14-29(24)22-9-4-2-7-19(22)17-32-26)18-28-15-12-20(13-16-28)30-23-10-5-3-8-21(23)27-25(30)31;5-3(6)1-2-4(7)8/h2-11,14,20H,12-13,15-18H2,1H3,(H,27,31);1-2H,(H,5,6)(H,7,8)/b;2-1-
InChI key:InChIKey=NGODOSILXOFQPH-BTJKTKAUSA-N
SMILES:C(C1(C)C=2N(C=3C(CO1)=CC=CC3)C=CC2)N4CCC(CC4)N5C=6C(NC5=O)=CC=CC6.C(=C\C(O)=O)\C(O)=O
Synonyms:- 1-{1-[(4-methyl-4H,6H-pyrrolo[1,2-a][4,1]benzoxazepin-4-yl)methyl]piperidin-4-yl}-1,3-dihydro-2H-benzimidazol-2-one
- 1-{1-[(4-methyl-4H,6H-pyrrolo[1,2-a][4,1]benzoxazepin-4-yl)methyl]piperidin-4-yl}-1,3-dihydro-2H-benzimidazol-2-one (2Z)-but-2-enedioate
- 2H-Benzimidazol-2-one, 1,3-dihydro-1-[1-[(4-methyl-4H,6H-pyrrolo[1,2-a][4,1]benzoxazepin-4-yl)methyl]-4-piperidinyl]-, (Z)-2-butenedioate (1:1)
- 4H,6H-Pyrrolo[1,2-a][4,1]benzoxazepine, 2H-benzimidazol-2-one deriv.
- Cgs-9343B
- Kw-5617
- Zaldaride maleate
- Zy-17617B
- 2H-Benzimidazol-2-one, 1,3-dihydro-1-[1-[(4-methyl-4H,6H-pyrrolo[1,2-a][4,1]benzoxazepin-4-yl)methyl]-4-piperidinyl]-, (2Z)-2-butenedioate (1:1)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
CGS 9343B
CAS:Controlled ProductFormula:C26H28N4O2·C4H4O4Color and Shape:NeatMolecular weight:544.598CGS 9343B
CAS:<p>CGS 9343B is a fatty acid that binds to calcium and calmodulin. It has been shown to have cytosolic calcium-dependent activity in skin cells, which may be due to its ability to induce the release of epidermal growth factor (EGF). CGS 9343B also inhibits atp levels and ATP-sensitive potassium channels in experimental models. This drug has been shown to inhibit the growth of diarrheal pathogens such as Clostridium difficile and Salmonella enterica.</p>Formula:C26H28N4O2·C4H4O4Purity:Min. 95%Molecular weight:544.61 g/molZaldaride maleate
CAS:Zaldaride maleate blocks Ca2+, Na+, K+ currents, and nAChR; inhibits CaM cAMP PDE (IC50: 3.3 nM) and estrogen signaling.Formula:C30H32N4O6Purity:98%Color and Shape:SolidMolecular weight:544.6



