CymitQuimica logo

CAS 109828-01-5

:

(2Z,16Z)-4,15-Dioxo-5,8,11,14-tetraoxaoctadeca-2,16-dienedioic acid

Description:
(2Z,16Z)-4,15-Dioxo-5,8,11,14-tetraoxaoctadeca-2,16-dienedioic acid is a complex organic compound characterized by its unique structure, which includes multiple functional groups and a long carbon chain. This substance features two double bonds (indicated by the Z configuration), which contribute to its reactivity and potential applications in various chemical processes. The presence of dioxo groups suggests that it may exhibit significant acidity and could participate in various chemical reactions, including esterification and condensation. The tetraoxaoctadeca structure indicates that it contains several ether linkages, which can influence its solubility and interaction with other molecules. This compound may be of interest in fields such as materials science, pharmaceuticals, or biochemistry due to its potential as a building block for more complex molecules or as a functional material. Its specific properties, such as melting point, boiling point, and solubility, would need to be determined through experimental methods, as they are not universally defined for all compounds.
Formula:C14H18O10
InChI:InChI=1S/C14H18O10/c15-11(16)1-3-13(19)23-9-7-21-5-6-22-8-10-24-14(20)4-2-12(17)18/h1-4H,5-10H2,(H,15,16)(H,17,18)/b3-1-,4-2-
InChI key:InChIKey=JWAZLOQEHBHDGM-CCAGOZQPSA-N
SMILES:C(/C=C\C(O)=O)(OCCOCCOCCOC(/C=C\C(O)=O)=O)=O
Synonyms:
  • 5,8,11,14-Tetraoxaoctadeca-2,16-dienedioic acid, 4,15-dioxo-, (2Z,16Z)-
  • (2Z,16Z)-4,15-Dioxo-5,8,11,14-tetraoxaoctadeca-2,16-dienedioic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.