CAS 1098340-10-3

2-(3-Bromophenyl)-1H-indole-3-carboxylic acid

Description:

2-(3-Bromophenyl)-1H-indole-3-carboxylic acid is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a bromophenyl group at the 2-position and a carboxylic acid functional group at the 3-position of the indole moiety contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. The bromine substituent can influence the compound's reactivity, making it a potential candidate for various chemical reactions, including electrophilic substitutions. Additionally, the carboxylic acid group can participate in hydrogen bonding and may affect the compound's acidity and overall polarity. Due to its structural features, this compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, as indole derivatives are known for their biological activity.

Formula: C₁₅H₁₀BrNO₂

InChI: InChI=1S/C15H10BrNO2/c16-10-5-3-4-9(8-10)14-13(15(18)19)11-6-1-2-7-12(11)17-14/h1-8,17H,(H,18,19)

InChI key: InChIKey=WGROSKJCWFTBRQ-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(NC=2C1=CC=CC2)C3=CC(Br)=CC=C3

Synonyms:

• 2-(3-Bromophenyl)-1H-indole-3-carboxylic acid
• 1H-Indole-3-carboxylic acid, 2-(3-bromophenyl)-