CymitQuimica logo

CAS 1098340-14-7

:

1-[(3,5-Difluorophenyl)methyl]-5-oxo-3-pyrrolidinecarboxylic acid

Description:
1-[(3,5-Difluorophenyl)methyl]-5-oxo-3-pyrrolidinecarboxylic acid is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring and a carboxylic acid functional group. The presence of the 3,5-difluorophenyl moiety contributes to its potential biological activity and lipophilicity, influencing its interactions in biological systems. The compound features a five-membered pyrrolidine ring, which is known for its role in various pharmacological activities. The oxo group (carbonyl) at the 5-position of the pyrrolidine enhances its reactivity and may play a role in its mechanism of action. This compound is of interest in medicinal chemistry, particularly for its potential applications in drug development, as modifications to the fluorophenyl group can lead to variations in potency and selectivity. Its specific properties, such as solubility, stability, and reactivity, would depend on the surrounding conditions and the presence of other functional groups. Overall, this compound exemplifies the complexity and diversity of organic molecules in pharmaceutical research.
Formula:C12H11F2NO3
InChI:InChI=1S/C12H11F2NO3/c13-9-1-7(2-10(14)4-9)5-15-6-8(12(17)18)3-11(15)16/h1-2,4,8H,3,5-6H2,(H,17,18)
InChI key:InChIKey=AQJCRGUHSRBSGR-UHFFFAOYSA-N
SMILES:C(N1CC(C(O)=O)CC1=O)C2=CC(F)=CC(F)=C2
Synonyms:
  • 3-Pyrrolidinecarboxylic acid, 1-[(3,5-difluorophenyl)methyl]-5-oxo-
  • 1-[(3,5-Difluorophenyl)methyl]-5-oxo-3-pyrrolidinecarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.