CAS 1098340-16-9
:N-(4-Chloro-3-methylphenyl)-1-piperazineacetamide
Description:
N-(4-Chloro-3-methylphenyl)-1-piperazineacetamide, identified by its CAS number 1098340-16-9, is a chemical compound that belongs to the class of piperazine derivatives. It features a piperazine ring, which is a six-membered nitrogen-containing heterocycle, and is substituted with an acetamide group and a chloro-methylphenyl moiety. This compound is characterized by its potential biological activity, often explored in medicinal chemistry for its pharmacological properties. The presence of the chloro and methyl groups on the phenyl ring can influence its lipophilicity and receptor binding affinity, making it a subject of interest in drug development. Additionally, the piperazine structure is known for its ability to interact with various neurotransmitter systems, which may contribute to its therapeutic effects. As with many chemical substances, safety and handling precautions are essential, as it may exhibit toxicity or other hazardous properties. Overall, N-(4-Chloro-3-methylphenyl)-1-piperazineacetamide represents a significant compound in the realm of pharmaceutical research.
Formula:C13H18ClN3O
InChI:InChI=1S/C13H18ClN3O/c1-10-8-11(2-3-12(10)14)16-13(18)9-17-6-4-15-5-7-17/h2-3,8,15H,4-7,9H2,1H3,(H,16,18)
InChI key:InChIKey=ZFLWFFGHBLRKGT-UHFFFAOYSA-N
SMILES:N(C(CN1CCNCC1)=O)C2=CC(C)=C(Cl)C=C2
Synonyms:- N-(4-Chloro-3-methylphenyl)-1-piperazineacetamide
- 1-Piperazineacetamide, N-(4-chloro-3-methylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.