CymitQuimica logo

CAS 1098340-23-8

:

N-(Tetrahydro-2,2-dimethyl-2H-pyran-4-yl)-3-pyridinemethanamine

Description:
N-(Tetrahydro-2,2-dimethyl-2H-pyran-4-yl)-3-pyridinemethanamine, identified by its CAS number 1098340-23-8, is a chemical compound characterized by its unique structural features, which include a pyridine ring and a tetrahydro-pyran moiety. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in various solvents. The presence of the pyridine ring suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. Additionally, the tetrahydro-pyran structure may contribute to its stability and reactivity, making it a candidate for further chemical modifications. Its molecular structure indicates that it may participate in various chemical reactions, including nucleophilic substitutions and cyclizations. Overall, this compound's characteristics make it of interest in both synthetic organic chemistry and potential therapeutic applications.
Formula:C13H20N2O
InChI:InChI=1S/C13H20N2O/c1-13(2)8-12(5-7-16-13)15-10-11-4-3-6-14-9-11/h3-4,6,9,12,15H,5,7-8,10H2,1-2H3
InChI key:InChIKey=FZXRWWCKNPASAJ-UHFFFAOYSA-N
SMILES:N(CC=1C=CC=NC1)C2CC(C)(C)OCC2
Synonyms:
  • N-(Tetrahydro-2,2-dimethyl-2H-pyran-4-yl)-3-pyridinemethanamine
  • 3-Pyridinemethanamine, N-(tetrahydro-2,2-dimethyl-2H-pyran-4-yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.