CymitQuimica logo

CAS 1098340-28-3

:

N1-[(4-Chlorophenyl)[2-(trifluoromethyl)phenyl]methyl]-1,2-ethanediamine

Description:
N1-[(4-Chlorophenyl)[2-(trifluoromethyl)phenyl]methyl]-1,2-ethanediamine, identified by its CAS number 1098340-28-3, is a chemical compound characterized by its complex structure, which includes a central ethanediamine moiety substituted with a 4-chlorophenyl group and a 2-(trifluoromethyl)phenyl group. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility and reactivity. The presence of the trifluoromethyl group often enhances lipophilicity and can affect biological activity, making it of interest in pharmaceutical research. Additionally, the chlorophenyl group may contribute to the compound's electronic properties, potentially influencing its interaction with biological targets. Overall, this compound's unique functional groups suggest potential applications in medicinal chemistry, particularly in the development of therapeutic agents. However, specific physical and chemical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.
Formula:C16H16ClF3N2
InChI:InChI=1S/C16H16ClF3N2/c17-12-7-5-11(6-8-12)15(22-10-9-21)13-3-1-2-4-14(13)16(18,19)20/h1-8,15,22H,9-10,21H2
InChI key:InChIKey=TURCTTRGNGELIE-UHFFFAOYSA-N
SMILES:C(NCCN)(C1=C(C(F)(F)F)C=CC=C1)C2=CC=C(Cl)C=C2
Synonyms:
  • 1,2-Ethanediamine, N1-[(4-chlorophenyl)[2-(trifluoromethyl)phenyl]methyl]-
  • N1-[(4-Chlorophenyl)[2-(trifluoromethyl)phenyl]methyl]-1,2-ethanediamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.