CAS 109857-65-0
:1-[4,4-Bis(4-methyl-2-thienyl)-3-buten-1-yl]-3-piperidinecarboxylic acid
Description:
1-[4,4-Bis(4-methyl-2-thienyl)-3-buten-1-yl]-3-piperidinecarboxylic acid, with the CAS number 109857-65-0, is a chemical compound characterized by its complex structure that includes a piperidine ring and a conjugated system featuring thienyl groups. This compound typically exhibits properties associated with both aromatic and aliphatic systems, which can influence its reactivity and solubility. The presence of the piperidine moiety suggests potential basicity, while the carboxylic acid functional group indicates acidic properties. The thienyl groups contribute to the compound's electronic characteristics, potentially enhancing its ability to participate in various chemical reactions, including electrophilic substitutions. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry. Its stability, solubility, and reactivity can vary depending on the solvent and environmental conditions. Overall, this compound's unique structural features make it a subject of interest for further research in both synthetic and applied chemistry contexts.
Formula:C20H25NO2S2
InChI:InChI=1S/C20H25NO2S2/c1-14-9-18(24-12-14)17(19-10-15(2)13-25-19)6-4-8-21-7-3-5-16(11-21)20(22)23/h6,9-10,12-13,16H,3-5,7-8,11H2,1-2H3,(H,22,23)
InChI key:InChIKey=OXZOKITXBCIECG-UHFFFAOYSA-N
SMILES:C(=CCCN1CC(C(O)=O)CCC1)(C2=CC(C)=CS2)C3=CC(C)=CS3
Synonyms:- 3-Piperidinecarboxylic acid, 1-[4,4-bis(4-methyl-2-thienyl)-3-buten-1-yl]-
- 1-[4,4-Bis(4-methyl-2-thienyl)-3-buten-1-yl]-3-piperidinecarboxylic acid
- 3-Piperidinecarboxylic acid, 1-[4,4-bis(4-methyl-2-thienyl)-3-butenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Tiagabine Isomer (1-(4,4-Bis(4-methylthiophen-2-yl)but-3-en-1-yl)piperidine-3-carboxylic acid)
CAS:Nucleic acids and their salts, whether or not chemically defined; other heterocyclic compounds, nesoiFormula:C20H25NO2S2Color and Shape:Brown SolidMolecular weight:375.13267

