
CAS 109857-81-0
:2,2′-(4-Bromo-1-butenylidene)bis[3-methylthiophene]
Description:
2,2′-(4-Bromo-1-butenylidene)bis[3-methylthiophene] is an organic compound characterized by its unique structure, which includes a central butenylidene group flanked by two 3-methylthiophene moieties. The presence of the bromine atom introduces notable reactivity, making it a potential candidate for various chemical reactions, including electrophilic substitutions. The thiophene rings contribute to the compound's aromatic character, enhancing its stability and electronic properties. This compound is likely to exhibit interesting optical and electronic behaviors, making it relevant in materials science, particularly in organic electronics and photonic applications. Additionally, the methyl groups on the thiophene rings can influence solubility and intermolecular interactions. Overall, 2,2′-(4-Bromo-1-butenylidene)bis[3-methylthiophene] presents a fascinating example of a functionalized thiophene derivative with potential applications in advanced materials and organic synthesis.
Formula:C14H15BrS2
InChI:InChI=1S/C14H15BrS2/c1-10-5-8-16-13(10)12(4-3-7-15)14-11(2)6-9-17-14/h4-6,8-9H,3,7H2,1-2H3
InChI key:InChIKey=KRXSGXVUQKRSCK-UHFFFAOYSA-N
SMILES:C(=CCCBr)(C1=C(C)C=CS1)C2=C(C)C=CS2
Synonyms:- 2-[4-Bromo-1-(3-methylthiophen-2-yl)but-1-enyl]-3-methylthiophene
- 2,2′-(4-Bromo-1-butenylidene)bis[3-methylthiophene]
- Thiophene, 2,2′-(4-bromo-1-butenylidene)bis[3-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2,2'-(4-Bromobut-1-ene-1,1-diyl)bis(3-methylthiophene)
CAS:Formula:C14H15BrS2Molecular weight:327.3029
