
CAS 109862-28-4
:Propanoic acid, 2-isocyano-2-methyl-
Description:
Propanoic acid, 2-isocyano-2-methyl- (CAS 109862-28-4) is an organic compound characterized by the presence of both a propanoic acid functional group and an isocyanide functional group. This compound features a three-carbon chain with a carboxylic acid (-COOH) at one end and an isocyanide (-N≡C) group attached to the second carbon. The isocyanide group is known for its unique reactivity, often participating in nucleophilic addition reactions. The presence of the methyl group at the second carbon contributes to the compound's overall structure and influences its chemical behavior. Propanoic acid derivatives are typically polar due to the carboxylic acid functional group, which can engage in hydrogen bonding, affecting their solubility in polar solvents. This compound may exhibit biological activity and could be of interest in synthetic organic chemistry, particularly in the development of pharmaceuticals or agrochemicals. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks.
Formula:C5H7NO2
InChI:InChI=1S/C5H7NO2/c1-5(2,6-3)4(7)8/h1-2H3,(H,7,8)
InChI key:InChIKey=GNHRTWYZEIYCRW-UHFFFAOYSA-N
SMILES:C(C(O)=O)([N+]#[C-])(C)C
Synonyms:- 2-Isocyano-2-methylpropanoic acid
- Propanoic acid, 2-isocyano-2-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.