CymitQuimica logo

CAS 109882-29-3

:

1H-Benzimidazole-2-butanoic acid,5-[bis(2-hydroxyethyl)amino]-1-methyl-, monohydrochloride

Description:
1H-Benzimidazole-2-butanoic acid, 5-[bis(2-hydroxyethyl)amino]-1-methyl-, monohydrochloride, with CAS number 109882-29-3, is a chemical compound characterized by its complex structure that includes a benzimidazole core, a butanoic acid moiety, and a bis(2-hydroxyethyl)amino group. This compound typically exhibits properties such as solubility in water due to the presence of polar functional groups, which enhances its bioavailability. It may also display acidic characteristics due to the carboxylic acid group, allowing it to participate in various chemical reactions. The presence of the bis(2-hydroxyethyl)amino group suggests potential for hydrogen bonding, which can influence its interaction with biological systems. This compound is of interest in pharmaceutical research, particularly for its potential therapeutic applications. Its hydrochloride salt form indicates that it is often used in a stable, soluble form for various applications, including drug formulation and biological studies. Overall, its unique structural features contribute to its chemical reactivity and potential utility in medicinal chemistry.
Formula:C16H23N3O4ClH
InChI:InChI=1S/C16H23N3O4.ClH/c1-18-14-6-5-12(19(7-9-20)8-10-21)11-13(14)17-15(18)3-2-4-16(22)23;/h5-6,11,20-21H,2-4,7-10H2,1H3,(H,22,23);1H
InChI key:GYNCQBRHZSHCNH-UHFFFAOYSA-N
SMILES:CN1C2=C(C=C(C=C2)N(CCO)CCO)N=C1CCCC(=O)O.Cl
Found 1 products.