
CAS 1099-73-6
:Benzenepropanaminium, γ-hydroxy-2,5-dimethoxy-N,N,N,α-tetramethyl-γ-phenyl-, iodide (1:1)
Description:
Benzenepropanaminium, γ-hydroxy-2,5-dimethoxy-N,N,N,α-tetramethyl-γ-phenyl-, iodide (1:1), with CAS number 1099-73-6, is a quaternary ammonium compound characterized by its complex structure that includes a benzene ring, a propanamine backbone, and multiple methoxy groups. This compound typically exhibits properties associated with quaternary ammonium salts, such as being a cationic surfactant, which can enhance solubility in aqueous solutions and facilitate interactions with biological membranes. The presence of methoxy groups contributes to its hydrophobic characteristics, while the iodide ion serves as a counterion, influencing its solubility and reactivity. The compound may also exhibit biological activity, potentially interacting with neurotransmitter systems due to its structural similarities to certain neurotransmitters. Its applications could span various fields, including pharmaceuticals and materials science, although specific uses may depend on further research into its properties and behavior in different environments. Safety and handling precautions are essential due to the potential toxicity associated with quaternary ammonium compounds.
Formula:C21H30NO3·I
InChI:InChI=1S/C21H30NO3.HI/c1-16(22(2,3)4)15-21(23,17-10-8-7-9-11-17)19-14-18(24-5)12-13-20(19)25-6;/h7-14,16,23H,15H2,1-6H3;1H/q+1;/p-1
InChI key:InChIKey=BIMKPYYUQXWQKN-UHFFFAOYSA-M
SMILES:C(CC([N+](C)(C)C)C)(O)(C1=C(OC)C=CC(OC)=C1)C2=CC=CC=C2.[I-]
Synonyms:- Ammonium, [3-(2,5-dimethoxyphenyl)-3-hydroxy-1-methyl-3-phenylpropyl]trimethyl-, iodide
- [3-(2,5-Dimethoxyphenyl)-3-hydroxy-1-methyl-3-phenylpropyl]trimethylammonium iodide
- Benzenepropanaminium, γ-hydroxy-2,5-dimethoxy-N,N,N,α-tetramethyl-γ-phenyl-, iodide
- Benzenepropanaminium, γ-hydroxy-2,5-dimethoxy-N,N,N,α-tetramethyl-γ-phenyl-, iodide (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
