CAS 109904-25-8
:4,5,6,7-Tetrahydro-5-(triphenylmethyl)thieno[3,2-c]pyridine
Description:
4,5,6,7-Tetrahydro-5-(triphenylmethyl)thieno[3,2-c]pyridine is a heterocyclic organic compound characterized by its complex structure, which includes a thieno[3,2-c]pyridine core fused with a tetrahydro moiety and a triphenylmethyl substituent. This compound typically exhibits a range of chemical properties, including moderate solubility in organic solvents due to its hydrophobic triphenylmethyl group. The presence of nitrogen and sulfur atoms in its structure contributes to its potential reactivity, making it of interest in various chemical reactions, including those involving nucleophilic substitutions or electrophilic additions. Its unique structure may also impart specific biological activities, making it a candidate for pharmaceutical research. Additionally, the compound's stability and reactivity can be influenced by the steric and electronic effects of the triphenylmethyl group, which can affect its interactions in biological systems or synthetic pathways. Overall, this compound represents a fascinating area of study in organic and medicinal chemistry.
Formula:C26H23NS
InChI:InChI=1/C26H23NS/c1-4-10-22(11-5-1)26(23-12-6-2-7-13-23,24-14-8-3-9-15-24)27-18-16-25-21(20-27)17-19-28-25/h1-15,17,19H,16,18,20H2
SMILES:c1ccc(cc1)C(c1ccccc1)(c1ccccc1)N1CCc2c(ccs2)C1
Synonyms:- 5-Trityl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin
- 4,5,6,7-Tetrahydro-5-tritylthieno[3,2-c]pyridine
- 5-Trityl-4,5,6,7-tetrahydrothieno[3,2-c]pyridine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
5-Trityl-4,5,6,7-tetrahydrothieno[3,2-c]pyridine
CAS:Formula:C26H23NSPurity:95%Color and Shape:SolidMolecular weight:381.53254,5,6,7-Tetrahydro-5-(triphenylmethyl)thieno[3,2-c]pyridine
CAS:Controlled ProductApplications 4,5,6,7-Tetrahydro-5-(triphenylmethyl)thieno[3,2-c]pyridine (cas# 109904-25-8) is a compound useful in organic synthesis.
Formula:C26H23NSColor and Shape:NeatMolecular weight:381.534,5,6,7-Tetrahydro-5-(triphenylmethyl)thieno[3,2-c]pyridine
CAS:Prasugrel is a pharmaceutical compound that belongs to the class of thienopyridines. It has been shown to inhibit platelet aggregation and is used for the prevention of blood clots in patients with coronary artery disease. Prasugrel binds to the P2Y12 receptor on the surface of platelets, which prevents ADP from binding, thereby inhibiting platelet aggregation. Prasugrel is a crystalline solid that is soluble in water.
Formula:C26H23NSPurity:Min. 95%Molecular weight:381.53 g/mol




