CAS 109904-37-2: 5,6,7,7a-Tetrahydrothieno[3,2-c]pyridin-2(4H)-one

Description:5,6,7,7a-Tetrahydrothieno[3,2-c]pyridin-2(4H)-one, with the CAS number 109904-37-2, is a heterocyclic compound featuring a fused thieno-pyridine structure. This compound is characterized by its bicyclic framework, which includes a thiophene ring and a pyridine ring, contributing to its unique chemical properties. It typically exhibits a solid-state at room temperature and is soluble in various organic solvents. The presence of the carbonyl group in the pyridinone moiety enhances its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and cycloadditions. Its structural features may impart biological activity, making it of interest in medicinal chemistry for potential therapeutic applications. Additionally, the compound's stereochemistry can influence its interactions and efficacy in biological systems. Overall, 5,6,7,7a-Tetrahydrothieno[3,2-c]pyridin-2(4H)-one represents a versatile scaffold for further chemical exploration and development.

Formula:C₇H₉NOS

InChI:InChI=1/C7H9NOS/c9-7-3-5-4-8-2-1-6(5)10-7/h3,6,8H,1-2,4H2

Found 3 products.

Product data	Purity	Price range	Estimated delivery
5,6,7,7a-Tetrahydrothieno[3,2-c]pyridin-2(4H)-one REF: IN-DA0094D7CAS: 109904-37-2	- - -	To inquire	Mon 24 Mar 25
5,6,7,7a-Tetrahydrothieno[3,2-c]pyridin-2(4H)-one REF: 10-F337817CAS: 109904-37-2	95.0%	- - -	Discontinued product
2H,4H,5H,6H,7H,7aH-Thieno[3,2-c]pyridin-2-one REF: 3D-JEA90437CAS: 109904-37-2	Min. 95%	- - -	Discontinued product