CAS 109906-48-1
:Quinine 1-oxide
Description:
Quinine 1-oxide, with the CAS number 109906-48-1, is a derivative of quinine, a well-known alkaloid primarily derived from the bark of the cinchona tree. This compound is characterized by its unique structural modifications that enhance its pharmacological properties. Quinine 1-oxide typically exhibits a bitter taste, similar to its parent compound, and is recognized for its potential antimalarial and analgesic effects. The presence of the oxide functional group may influence its solubility and reactivity compared to quinine. In terms of physical properties, quinine derivatives often display fluorescence, which can be utilized in various analytical techniques. Quinine 1-oxide is of interest in medicinal chemistry for its potential therapeutic applications, particularly in the treatment of malaria and other diseases. However, its specific biological activity, toxicity, and pharmacokinetics require further investigation to fully understand its role in medicinal applications. As with many chemical substances, safety precautions should be observed when handling quinine 1-oxide in laboratory settings.
Formula:C20H24N2O3
InChI:InChI=1S/C20H24N2O3/c1-3-13-12-22(24)9-7-14(13)10-19(22)20(23)16-6-8-21-18-5-4-15(25-2)11-17(16)18/h3-6,8,11,13-14,19-20,23H,1,7,9-10,12H2,2H3/t13-,14-,19-,20+,22+/m0/s1
InChI key:InChIKey=WVDIZKMXQMCCAA-CURGQOQWSA-N
SMILES:[C@H](O)([C@]1(N2(=O)C[C@H](C=C)[C@](C1)(CC2)[H])[H])C=3C4=C(C=CC(OC)=C4)N=CC3
Synonyms:- Cinchonan-9-ol, 6′-methoxy-, 1-oxide, (8α,9R)-
- Quinine 1-Oxid
- Quinine 1-oxide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

