CAS 109912-34-7
:5-[{2-[(4-methoxybenzyl)(pyridin-2-yl)amino]ethyl}(methyl)amino]pentanenitrile
Description:
5-[{2-[(4-methoxybenzyl)(pyridin-2-yl)amino]ethyl}(methyl)amino]pentanenitrile, with the CAS number 109912-34-7, is a synthetic organic compound characterized by its complex structure, which includes a pentanenitrile backbone and multiple functional groups. The presence of a nitrile group (-C≡N) indicates potential reactivity, particularly in nucleophilic addition reactions. The compound features a pyridine ring, which contributes to its aromatic properties and may influence its biological activity, as pyridine derivatives are often associated with pharmacological effects. Additionally, the methoxybenzyl group enhances lipophilicity, potentially affecting the compound's solubility and permeability in biological systems. The presence of amino groups suggests that the compound may engage in hydrogen bonding, which can be crucial for interactions with biological targets. Overall, this compound's unique combination of functional groups and structural features may render it of interest in medicinal chemistry and drug development, although specific biological activities would require further investigation through experimental studies.
Formula:C21H28N4O
InChI:InChI=1/C21H28N4O/c1-24(15-7-3-5-13-22)16-17-25(21-8-4-6-14-23-21)18-19-9-11-20(26-2)12-10-19/h4,6,8-12,14H,3,5,7,15-18H2,1-2H3
SMILES:CN(CCCCC#N)CCN(Cc1ccc(cc1)OC)c1ccccn1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N'-(4-Cyanobutyl)-N-(4-methoxybenzyl)-N'-methyl-N-2-pyridinyl-1,2-ethanediamine
CAS:Controlled ProductApplications N’-(4-Cyanobutyl)-N-(4-methoxybenzyl)-N’-methyl-N-2-pyridinyl-1,2-ethanediamine (cas# 109912-34-7) is a compound useful in organic synthesis.
Formula:C21H28N4OColor and Shape:NeatMolecular weight:352.47
