CymitQuimica logo

CAS 109926-15-0

:

2-[(2-methoxybenzyl)amino]ethanol

Description:
2-[(2-Methoxybenzyl)amino]ethanol, with the CAS number 109926-15-0, is an organic compound characterized by the presence of both an amino group and an alcohol functional group. This compound features a methoxybenzyl moiety, which contributes to its aromatic properties, and an ethanol backbone that provides hydrophilicity. The amino group allows for potential interactions such as hydrogen bonding, making it soluble in polar solvents. Its structure suggests it may exhibit biological activity, possibly serving as a precursor or intermediate in the synthesis of pharmaceuticals or agrochemicals. The presence of the methoxy group can influence its electronic properties and reactivity, potentially affecting its interaction with biological targets. Additionally, the compound's molecular structure may confer specific physical properties, such as melting and boiling points, which are influenced by intermolecular forces. Overall, 2-[(2-methoxybenzyl)amino]ethanol is a versatile compound with potential applications in various fields, including medicinal chemistry and materials science.
Formula:C10H15NO2
InChI:InChI=1/C10H15NO2/c1-13-10-5-3-2-4-9(10)8-11-6-7-12/h2-5,11-12H,6-8H2,1H3
SMILES:COc1ccccc1CNCCO
Synonyms:
  • Ethanol, 2-[[(2-Methoxyphenyl)Methyl]Amino]-
  • 2-[(2-Methoxybenzyl)amino]ethanol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.