CAS 109926-16-1
:3-[(2-methoxybenzyl)amino]propan-1-ol
Description:
3-[(2-Methoxybenzyl)amino]propan-1-ol, with the CAS number 109926-16-1, is an organic compound characterized by its amine and alcohol functional groups. This substance features a propanol backbone, where a benzyl group substituted with a methoxy group is attached to the nitrogen atom of the amino group. The presence of the methoxy group enhances its lipophilicity, potentially influencing its biological activity and solubility in organic solvents. The compound is likely to exhibit moderate polarity due to the hydroxyl (-OH) group, which can participate in hydrogen bonding. Its structural characteristics suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with similar structures often exhibit interesting biological properties. Additionally, the compound's stability and reactivity can be influenced by the presence of the methoxy and amino groups, making it a candidate for further study in various chemical reactions or as a building block in organic synthesis.
Formula:C11H17NO2
InChI:InChI=1/C11H17NO2/c1-14-11-6-3-2-5-10(11)9-12-7-4-8-13/h2-3,5-6,12-13H,4,7-9H2,1H3
SMILES:COc1ccccc1CNCCCO
Synonyms:- 1-Propanol, 3-[[(2-Methoxyphenyl)Methyl]Amino]-
- 3-[(2-Methoxybenzyl)amino]propan-1-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.