CAS 109926-37-6
:2,3-Dihydro-6-methoxy-3-benzofuranamine
Description:
2,3-Dihydro-6-methoxy-3-benzofuranamine is a chemical compound characterized by its unique structural features, which include a benzofuran core and an amine functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The presence of the methoxy group enhances its lipophilicity, which may influence its interaction with biological membranes and receptors. As a benzofuran derivative, it may exhibit various pharmacological properties, making it of interest in medicinal chemistry. The compound's molecular structure suggests potential for hydrogen bonding due to the amine group, which can affect its solubility and reactivity. Additionally, the dihydro configuration indicates that it may participate in various chemical reactions, including oxidation and substitution. Overall, 2,3-Dihydro-6-methoxy-3-benzofuranamine represents a class of compounds that could be explored for therapeutic applications, although specific biological activities and mechanisms would require further investigation through experimental studies.
Formula:C9H11NO2
InChI:InChI=1S/C9H11NO2/c1-11-6-2-3-7-8(10)5-12-9(7)4-6/h2-4,8H,5,10H2,1H3
InChI key:InChIKey=UBNFZTRISBVHJR-UHFFFAOYSA-N
SMILES:NC1C=2C(=CC(OC)=CC2)OC1
Synonyms:- 2,3-Dihydro-6-methoxy-3-benzofuranamine
- 3-Benzofuranamine, 2,3-dihydro-6-methoxy-
- 6-METHOXY-2,3-DIHYDROBENZOFURAN-3-AMINE HCL
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.