CymitQuimica logo

CAS 109935-34-4

:

4,4'-[pentane-1,5-diylbis(oxy)]bis(N-methylanilinium) dichloride

Description:
4,4'-[Pentane-1,5-diylbis(oxy)]bis(N-methylanilinium) dichloride is a quaternary ammonium compound characterized by its dual cationic structure, which includes two N-methylanilinium groups linked by a pentane-1,5-diyl bis(oxy) moiety. This compound typically exhibits properties associated with quaternary ammonium salts, such as high solubility in polar solvents and potential surfactant behavior. It may also demonstrate antimicrobial activity due to the presence of the cationic nitrogen atoms, which can interact with microbial membranes. The dichloride form indicates the presence of two chloride ions, contributing to its ionic nature. Its molecular structure suggests potential applications in various fields, including pharmaceuticals, materials science, and as a surfactant or emulsifier in formulations. Additionally, the presence of the methylaniline groups may impart specific electronic and steric properties, influencing its reactivity and interaction with other chemical species. Safety and handling precautions should be observed, as with many quaternary ammonium compounds, due to potential toxicity and environmental impact.
Formula:C19H28Cl2N2O2
InChI:InChI=1/C19H26N2O2.2ClH/c1-20-16-6-10-18(11-7-16)22-14-4-3-5-15-23-19-12-8-17(21-2)9-13-19;;/h6-13,20-21H,3-5,14-15H2,1-2H3;2*1H
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.