CAS 109936-21-2

2-(4-Chlorophenyl)-1,1-diphenylethanol

Description:

2-(4-Chlorophenyl)-1,1-diphenylethanol, with the CAS number 109936-21-2, is an organic compound characterized by its complex structure featuring a central ethanol moiety substituted with two phenyl groups and a para-chlorophenyl group. This compound typically exhibits properties associated with alcohols, including the ability to form hydrogen bonds, which can influence its solubility and reactivity. It is likely to be a solid at room temperature, given the presence of multiple aromatic rings that contribute to its stability and melting point. The chlorophenyl substituent may impart specific electronic effects, potentially affecting the compound's reactivity in various chemical reactions, such as nucleophilic substitutions or electrophilic aromatic substitutions. Additionally, due to its structural characteristics, it may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₂₀H₁₇ClO

InChI: InChI=1/C20H17ClO/c21-19-13-11-16(12-14-19)15-20(22,17-7-3-1-4-8-17)18-9-5-2-6-10-18/h1-14,22H,15H2

SMILES: c1ccc(cc1)C(Cc1ccc(cc1)Cl)(c1ccccc1)O

Synonyms:

• 4-Chlorobenzyl diphenyl carbinol~Clox-H~H-clox

2-(4-Chlorophenyl)-1,1-diphenylethanol

CAS: 109936-21-2

Formula: C₂₀H₁₇ClO

Color and Shape: Solid

Molecular weight: 308.8014

Ref: IN-DA0084NV

4-Chlorobenzyl diphenyl carbinol

CAS: 109936-21-2

4-Chlorobenzyl diphenyl carbinol is an organic compound that is used as a reagent, intermediate, and building block in the synthesis of other compounds. The product is a white, crystalline solid and has a molecular weight of 243.3 g/mol. It can be used as a scaffold for the synthesis of new chemical compounds or as a building block to create speciality chemicals. 4-Chlorobenzyl diphenyl carbinol has been shown to react with a variety of functional groups and can be used in both research and industrial contexts.

Formula: C₂₀H₁₇ClO

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 308.8 g/mol

Ref: 3D-FC67940