CAS 109944-15-2: Kifunensine, Kitasatosporia kifunense
Description:Kifunensine is a natural product derived from the actinobacterium Kitasatosporia kifunense, known for its role as a potent inhibitor of glycosylation processes. It is classified as a mannosidase inhibitor, specifically targeting the enzyme α-mannosidase, which is crucial in the processing of glycoproteins. This inhibition can affect various biological pathways, making kifunensine a valuable tool in biochemical research, particularly in studies related to protein folding and glycosylation. The compound is characterized by its complex structure, which includes multiple functional groups that contribute to its biological activity. Kifunensine has garnered interest for its potential applications in therapeutic contexts, particularly in cancer research and the study of viral infections, where glycosylation plays a significant role in pathogen-host interactions. Additionally, its unique properties make it a subject of interest in the field of medicinal chemistry, where understanding its mechanism of action could lead to the development of novel therapeutic agents.
Formula:C8H12N2O6
InChI:InChI=1S/C8H12N2O6/c11-1-2-3(12)4(13)5(14)6-9-7(15)8(16)10(2)6/h2-6,11-14H,1H2,(H,9,15)/t2-,3-,4+,5+,6+/m1/s1
InChI key:InChIKey=OIURYJWYVIAOCW-PQMKYFCFSA-N
SMILES:O=C1NC2N(C1=O)C(CO)C(O)C(O)C2O
- Synonyms:
- (5R,6R,7S,8R,8aS)-6,7,8-trihydroxy-5-(hydroxymethyl)hexahydroimidazo[1,2-a]pyridine-2,3-dione
- (5R,6R,7S,8R,8aS)-Hexahydro-6,7,8-trihydroxy-5-(hydroxymethyl)imidazo[1,2-a]pyridine-2,3-dione
- Fr 900494
- Imidazo[1,2-a]pyridine-2,3-dione, hexahydro-6,7,8-trihydroxy-5-(hydroxymethyl)-, (5R,6R,7S,8R,8aS)-
- Imidazo[1,2-a]pyridine-2,3-dione, hexahydro-6,7,8-trihydroxy-5-(hydroxymethyl)-, [5R-(5α,6β,7α,8α,8aα)]-
- Kifunensine