CAS 109946-35-2
:Tautomycin
Description:
Tautomycin is a natural product classified as a polyketide, primarily known for its potent biological activities, particularly as an inhibitor of protein phosphatases. It is derived from the fermentation of certain Streptomyces species. The compound exhibits a complex structure characterized by multiple functional groups, including a lactone and a hydroxyl group, which contribute to its reactivity and biological interactions. Tautomycin has garnered interest in medicinal chemistry due to its potential therapeutic applications, particularly in cancer research, as it can modulate cellular signaling pathways. Its mechanism of action involves the selective inhibition of serine/threonine phosphatases, which play crucial roles in various cellular processes, including cell division and apoptosis. Additionally, Tautomycin's stability and solubility properties make it a subject of study for drug formulation. However, due to its biological activity, careful consideration of its pharmacokinetics and toxicity is essential in any potential therapeutic application. Overall, Tautomycin represents a significant compound in the field of natural products and medicinal chemistry.
Formula:C41H66O13
InChI:InChI=1S/C41H66O13/c1-21(2)36(51-34(47)20-31(45)35-27(8)39(48)52-40(35)49)38(50-10)32(46)19-30(44)26(7)29(43)13-11-24(5)37-25(6)16-18-41(54-37)17-15-23(4)33(53-41)14-12-22(3)28(9)42/h21-26,29,31-33,36-38,43,45-46H,11-20H2,1-10H3/t22-,23+,24+,25-,26-,29-,31+,32+,33-,36+,37-,38-,41+/m0/s1
InChI key:InChIKey=RFCWHQNNCOJYTR-QKIDKDKQSA-N
SMILES:[C@H](CC[C@@H]([C@@H](C(C[C@H]([C@@H]([C@H](OC(C[C@@H](O)C1=C(C)C(=O)OC1=O)=O)C(C)C)OC)O)=O)C)O)(C)[C@@]2(O[C@@]3(O[C@@H](CC[C@@H](C(C)=O)C)[C@H](C)CC3)CC[C@@H]2C)[H]
Synonyms:- (3R,4R,5R,8S,9S,12R)-12-{(2S,3S,6R,8S,9R)-3,9-dimethyl-8-[(3S)-3-methyl-4-oxopentyl]-1,7-dioxaspiro[5.5]undec-2-yl}-5,9-dihydroxy-4-methoxy-2,8-dimethyl-7-oxotridecan-3-yl (3R)-3-hydroxy-3-(4-methyl-2,5-dioxo-2,5-dihydrofuran-3-yl)propanoate
- 3-Furanpropanoic acid, 2,5-dihydro-β-hydroxy-4-methyl-2,5-dioxo-, (1R,2S,3R,6S,7S,10R)-10-[(2S,3S,6R,8S,9R)-3,9-dimethyl-8-[(3S)-3-methyl-4-oxopentyl]-1,7-dioxaspiro[5.5]undec-2-yl]-3,7-dihydroxy-2-methoxy-6-methyl-1-(1-methylethyl)-5-oxoundecyl ester, (βR)-
- 3-Furanpropanoic acid, 2,5-dihydro-β-hydroxy-4-methyl-2,5-dioxo-, 10-[3,9-dimethyl-8-(3-methyl-4-oxopentyl)-1,7-dioxaspiro[5.5]undec-2-yl]-3,7-dihydroxy-2-methoxy-6-methyl-1-(1-methylethyl)-5-oxoundecyl ester, [2S-[2α[1S*(S*),2R*,3S*,6R*,7R*,10S*],3α,6β[8R*(R*),9S*]]]-
- Tautomycin From Streptomyces Spiroverti- Cillatus, 50 Ug
- Tautomycin From Streptomyces Spiroverticillatus
- Tautomycin
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Tautomycin
CAS:Tautomycin: PP1 & PP2A inhibitor (Kiapp 0.16/0.4 nM), antifungal from Streptomyces verticillatus.Formula:C41H66O13Purity:98%Color and Shape:SolidMolecular weight:766.95Tautomycin from Streptomyces spiroverticillatus
CAS:<p>Tautomycin is a natural compound classified as a polyketide, which is isolated from the bacterium *Streptomyces spiroverticillatus*. This bacterium is renowned for its ability to produce biologically active secondary metabolites with diverse pharmacological properties. Tautomycin is recognized for its mode of action as a potent inhibitor of protein phosphatases, specifically protein phosphatase 1 (PP1) and protein phosphatase 2A (PP2A). These enzymes play critical roles in cellular processes by regulating phosphorylation states, which control various signaling pathways within the cell.</p>Formula:C41H66O13Purity:Min. 95%Color and Shape:PowderMolecular weight:766.95 g/mol

