CAS 1099597-18-8

2-Chloro-4-(2,2,2-trifluoroethyl)-1-(trifluoromethyl)benzene

Description:

2-Chloro-4-(2,2,2-trifluoroethyl)-1-(trifluoromethyl)benzene, with the CAS number 1099597-18-8, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with both chloro and trifluoromethyl groups. The presence of the trifluoroethyl group enhances its fluorine content, contributing to its unique chemical properties, such as increased lipophilicity and potential applications in various fields, including agrochemicals and pharmaceuticals. This compound is likely to exhibit high thermal stability and resistance to degradation due to the strong C-F bonds present in the trifluoromethyl and trifluoroethyl substituents. Additionally, its chlorinated nature may impart specific reactivity patterns, making it a candidate for further chemical transformations. The compound's physical properties, such as boiling point, melting point, and solubility, would be influenced by the electron-withdrawing effects of the fluorine and chlorine atoms, which can also affect its behavior in biological systems and environmental interactions. Safety and handling precautions are essential due to the potential toxicity associated with halogenated compounds.

Formula: C₉H₅ClF₆

InChI: InChI=1S/C9H5ClF6/c10-7-3-5(4-8(11,12)13)1-2-6(7)9(14,15)16/h1-3H,4H2

InChI key: InChIKey=LYRACGYCLAJZMA-UHFFFAOYSA-N

SMILES: C(C(F)(F)F)C1=CC(Cl)=C(C(F)(F)F)C=C1

Synonyms:

• 2-Chloro-4-(2,2,2-trifluoroethyl)-1-(trifluoromethyl)benzene
• Benzene, 2-chloro-4-(2,2,2-trifluoroethyl)-1-(trifluoromethyl)-