CAS 1099597-24-6

1-Ethyl-4-(3,3,3-trifluoropropyl)benzene

Description:

1-Ethyl-4-(3,3,3-trifluoropropyl)benzene is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with an ethyl group and a trifluoropropyl group. The presence of the trifluoropropyl group introduces significant fluorine content, which can influence the compound's physical and chemical properties, such as polarity, volatility, and reactivity. This compound is likely to be a colorless liquid at room temperature, exhibiting low solubility in water due to its hydrophobic nature, while being more soluble in organic solvents. The trifluoromethyl groups can enhance the compound's stability and resistance to oxidation. Additionally, the compound may possess unique properties such as increased lipophilicity and potential applications in fields like materials science, pharmaceuticals, or as a solvent. Safety data should be consulted for handling and potential hazards, as the presence of fluorine can pose specific environmental and health risks. Overall, 1-Ethyl-4-(3,3,3-trifluoropropyl)benzene represents a specialized compound with distinct characteristics influenced by its molecular structure.

Formula: C₁₁H₁₃F₃

InChI: InChI=1S/C11H13F3/c1-2-9-3-5-10(6-4-9)7-8-11(12,13)14/h3-6H,2,7-8H2,1H3

InChI key: InChIKey=CVIOHYXZHXXAIB-UHFFFAOYSA-N

SMILES: C(CC(F)(F)F)C1=CC=C(CC)C=C1

Synonyms:

• Benzene, 1-ethyl-4-(3,3,3-trifluoropropyl)-
• 1-Ethyl-4-(3,3,3-trifluoropropyl)benzene